3-(3,4-dichlorophenyl)-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(3,4-dichlorophenyl)-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}quinazolin-4(3H)-one
3-(3,4-dichlorophenyl)-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | V006-4496 |
| Compound Name: | 3-(3,4-dichlorophenyl)-2-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}quinazolin-4(3H)-one |
| Molecular Weight: | 455.36 |
| Molecular Formula: | C23 H16 Cl2 N2 O2 S |
| Smiles: | Cc1ccc(cc1)C(CSC1=Nc2ccccc2C(N1c1ccc(c(c1)[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4638 |
| logD: | 5.4636 |
| logSw: | -5.8232 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.406 |
| InChI Key: | MLCJGCPZOKPAEM-UHFFFAOYSA-N |