4-({(cyclohexanecarbonyl)[2-(dimethylamino)ethyl]amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
Chemical Structure Depiction of
4-({(cyclohexanecarbonyl)[2-(dimethylamino)ethyl]amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
4-({(cyclohexanecarbonyl)[2-(dimethylamino)ethyl]amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
Compound characteristics
| Compound ID: | V006-5623 |
| Compound Name: | 4-({(cyclohexanecarbonyl)[2-(dimethylamino)ethyl]amino}methyl)phenyl 4-fluorobenzene-1-sulfonate |
| Molecular Weight: | 462.58 |
| Molecular Formula: | C24 H31 F N2 O4 S |
| Salt: | not_available |
| Smiles: | CN(C)CCN(Cc1ccc(cc1)OS(c1ccc(cc1)F)(=O)=O)C(C1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1934 |
| logD: | 3.2293 |
| logSw: | -4.0562 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.247 |
| InChI Key: | QJYZPFBEMJXTIZ-UHFFFAOYSA-N |