N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(furan-2-yl)methyl]-N'-(propan-2-yl)urea
Chemical Structure Depiction of
N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(furan-2-yl)methyl]-N'-(propan-2-yl)urea
N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(furan-2-yl)methyl]-N'-(propan-2-yl)urea
Compound characteristics
| Compound ID: | V006-6492 |
| Compound Name: | N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(furan-2-yl)methyl]-N'-(propan-2-yl)urea |
| Molecular Weight: | 476.55 |
| Molecular Formula: | C27 H29 F N4 O3 |
| Smiles: | CCc1c(CN(Cc2ccco2)C(NC(C)C)=O)c(n(c2ccc(cc2)F)n1)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.9123 |
| logD: | 5.9123 |
| logSw: | -5.5342 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.686 |
| InChI Key: | LXQTYIRVJCGTKI-UHFFFAOYSA-N |