ethyl N-({4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(1-phenylethyl)carbamoyl]phenyl}carbamoyl)glycinate
Chemical Structure Depiction of
ethyl N-({4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(1-phenylethyl)carbamoyl]phenyl}carbamoyl)glycinate
ethyl N-({4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(1-phenylethyl)carbamoyl]phenyl}carbamoyl)glycinate
Compound characteristics
| Compound ID: | V006-7876 |
| Compound Name: | ethyl N-({4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[(1-phenylethyl)carbamoyl]phenyl}carbamoyl)glycinate |
| Molecular Weight: | 559.67 |
| Molecular Formula: | C31 H37 N5 O5 |
| Salt: | not_available |
| Smiles: | CCOC(CNC(Nc1ccc(c(c1)C(NC(C)c1ccccc1)=O)N1CCN(CC1)c1ccccc1OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6535 |
| logD: | 4.6535 |
| logSw: | -4.2653 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 91.612 |
| InChI Key: | QDKWZYZEINMYNW-QFIPXVFZSA-N |