2-{[(4-chlorophenyl)methyl]sulfanyl}-N-[4-(2-fluorophenyl)-3-(methoxymethyl)-1,2-oxazol-5-yl]acetamide
Chemical Structure Depiction of
2-{[(4-chlorophenyl)methyl]sulfanyl}-N-[4-(2-fluorophenyl)-3-(methoxymethyl)-1,2-oxazol-5-yl]acetamide
2-{[(4-chlorophenyl)methyl]sulfanyl}-N-[4-(2-fluorophenyl)-3-(methoxymethyl)-1,2-oxazol-5-yl]acetamide
Compound characteristics
| Compound ID: | V006-8133 |
| Compound Name: | 2-{[(4-chlorophenyl)methyl]sulfanyl}-N-[4-(2-fluorophenyl)-3-(methoxymethyl)-1,2-oxazol-5-yl]acetamide |
| Molecular Weight: | 420.89 |
| Molecular Formula: | C20 H18 Cl F N2 O3 S |
| Smiles: | COCc1c(c2ccccc2F)c(NC(CSCc2ccc(cc2)[Cl])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.1096 |
| logD: | 3.6631 |
| logSw: | -4.9787 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.622 |
| InChI Key: | IXKSWPZLLMGAQG-UHFFFAOYSA-N |