1-[(3-fluorophenyl)methyl]-4-[4-fluoro-2-(trifluoromethyl)benzamido]-1H-indol-5-yl diethylcarbamate
Chemical Structure Depiction of
1-[(3-fluorophenyl)methyl]-4-[4-fluoro-2-(trifluoromethyl)benzamido]-1H-indol-5-yl diethylcarbamate
1-[(3-fluorophenyl)methyl]-4-[4-fluoro-2-(trifluoromethyl)benzamido]-1H-indol-5-yl diethylcarbamate
Compound characteristics
| Compound ID: | V006-8276 |
| Compound Name: | 1-[(3-fluorophenyl)methyl]-4-[4-fluoro-2-(trifluoromethyl)benzamido]-1H-indol-5-yl diethylcarbamate |
| Molecular Weight: | 545.51 |
| Molecular Formula: | C28 H24 F5 N3 O3 |
| Smiles: | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cccc(c2)F)c1NC(c1ccc(cc1C(F)(F)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8286 |
| logD: | 4.4267 |
| logSw: | -5.7094 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.74 |
| InChI Key: | BNZLQJXLEFOTTA-UHFFFAOYSA-N |