ethyl 2-{[(5-fluoro-2-methylphenyl)methyl]sulfanyl}-1-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-5-carboxylate
Chemical Structure Depiction of
ethyl 2-{[(5-fluoro-2-methylphenyl)methyl]sulfanyl}-1-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-5-carboxylate
ethyl 2-{[(5-fluoro-2-methylphenyl)methyl]sulfanyl}-1-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-5-carboxylate
Compound characteristics
| Compound ID: | V006-9279 |
| Compound Name: | ethyl 2-{[(5-fluoro-2-methylphenyl)methyl]sulfanyl}-1-[2-(4-methoxyphenyl)ethyl]-1H-benzimidazole-5-carboxylate |
| Molecular Weight: | 478.59 |
| Molecular Formula: | C27 H27 F N2 O3 S |
| Salt: | not_available |
| Smiles: | CCOC(c1ccc2c(c1)nc(n2CCc1ccc(cc1)OC)SCc1cc(ccc1C)F)=O |
| Stereo: | ACHIRAL |
| logP: | 7.5405 |
| logD: | 7.535 |
| logSw: | -5.6207 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.753 |
| InChI Key: | OBZYYWBWLCJYRS-UHFFFAOYSA-N |