N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
Chemical Structure Depiction of
N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-2-phenyl-N-propylbutanamide
Compound characteristics
| Compound ID: | V006-9726 |
| Compound Name: | N-{[2-(dimethylamino)-5-(2-methylpropanamido)phenyl]methyl}-2-phenyl-N-propylbutanamide |
| Molecular Weight: | 423.6 |
| Molecular Formula: | C26 H37 N3 O2 |
| Salt: | not_available |
| Smiles: | CCCN(Cc1cc(ccc1N(C)C)NC(C(C)C)=O)C(C(CC)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3833 |
| logD: | 5.3813 |
| logSw: | -5.34 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.294 |
| InChI Key: | GYNJAWZPEWWERD-HSZRJFAPSA-N |