N-benzyl-2-chloro-N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}benzamide
Chemical Structure Depiction of
N-benzyl-2-chloro-N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}benzamide
N-benzyl-2-chloro-N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}benzamide
Compound characteristics
| Compound ID: | V006-9761 |
| Compound Name: | N-benzyl-2-chloro-N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}benzamide |
| Molecular Weight: | 516.01 |
| Molecular Formula: | C30 H27 Cl F N3 O2 |
| Salt: | not_available |
| Smiles: | CN(C)c1ccc(cc1CN(Cc1ccccc1)C(c1ccccc1[Cl])=O)NC(c1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9706 |
| logD: | 5.9552 |
| logSw: | -5.8286 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.773 |
| InChI Key: | ZUEPDDLZKGVCPE-UHFFFAOYSA-N |