4-[(4-fluorophenyl)methyl]-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
Chemical Structure Depiction of
4-[(4-fluorophenyl)methyl]-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
4-[(4-fluorophenyl)methyl]-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
Compound characteristics
| Compound ID: | V007-0967 |
| Compound Name: | 4-[(4-fluorophenyl)methyl]-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine |
| Molecular Weight: | 375.5 |
| Molecular Formula: | C21 H26 F N O2 S |
| Smiles: | CC(C)c1ccc(cc1)S(N1CCC(CC1)Cc1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7689 |
| logD: | 5.7689 |
| logSw: | -5.661 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.678 |
| InChI Key: | QDCBJKXYUDRDNU-UHFFFAOYSA-N |