N-{2-[3-(2-fluorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-4-methoxy-N-methylbenzamide
Chemical Structure Depiction of
N-{2-[3-(2-fluorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-4-methoxy-N-methylbenzamide
N-{2-[3-(2-fluorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-4-methoxy-N-methylbenzamide
Compound characteristics
| Compound ID: | V007-1050 |
| Compound Name: | N-{2-[3-(2-fluorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-4-methoxy-N-methylbenzamide |
| Molecular Weight: | 475.52 |
| Molecular Formula: | C27 H26 F N3 O4 |
| Smiles: | CN(CC(N1C(CC(c2ccccc2F)=N1)c1ccc(cc1)OC)=O)C(c1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9811 |
| logD: | 3.9811 |
| logSw: | -4.2368 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.097 |
| InChI Key: | GKFWFGKMRYDVDJ-RUZDIDTESA-N |