benzyl [butyl(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)amino]acetate
Chemical Structure Depiction of
benzyl [butyl(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)amino]acetate
benzyl [butyl(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)amino]acetate
Compound characteristics
| Compound ID: | V007-1058 |
| Compound Name: | benzyl [butyl(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)amino]acetate |
| Molecular Weight: | 476.62 |
| Molecular Formula: | C29 H36 N2 O4 |
| Salt: | not_available |
| Smiles: | CCCCN(CC(N(CCc1ccccc1)Cc1ccc(C)o1)=O)CC(=O)OCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.2945 |
| logD: | 5.2943 |
| logSw: | -5.0686 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.388 |
| InChI Key: | XQZHMQHPMQXPPI-UHFFFAOYSA-N |