3-[2-(morpholin-4-yl)-2-oxoethyl]-4-oxo-1-phenyl-N-[4-(propan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide
Chemical Structure Depiction of
3-[2-(morpholin-4-yl)-2-oxoethyl]-4-oxo-1-phenyl-N-[4-(propan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide
3-[2-(morpholin-4-yl)-2-oxoethyl]-4-oxo-1-phenyl-N-[4-(propan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide
Compound characteristics
| Compound ID: | V007-1513 |
| Compound Name: | 3-[2-(morpholin-4-yl)-2-oxoethyl]-4-oxo-1-phenyl-N-[4-(propan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| Molecular Weight: | 519.64 |
| Molecular Formula: | C29 H37 N5 O4 |
| Smiles: | CC(C)c1ccc(cc1)NC(N1CCC2(CC1)C(N(CC(N1CCOCC1)=O)CN2c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3604 |
| logD: | 3.3604 |
| logSw: | -3.4981 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.026 |
| InChI Key: | VEMXCLHKJCPQGB-UHFFFAOYSA-N |