N-benzyl-5-[(3-methoxyphenyl)carbamamido]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide
Chemical Structure Depiction of
N-benzyl-5-[(3-methoxyphenyl)carbamamido]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide
N-benzyl-5-[(3-methoxyphenyl)carbamamido]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide
Compound characteristics
| Compound ID: | V007-2015 |
| Compound Name: | N-benzyl-5-[(3-methoxyphenyl)carbamamido]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| Molecular Weight: | 565.67 |
| Molecular Formula: | C33 H35 N5 O4 |
| Salt: | not_available |
| Smiles: | COc1cccc(c1)NC(Nc1ccc(c(c1)C(NCc1ccccc1)=O)N1CCN(CC1)c1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 6.412 |
| logD: | 6.4119 |
| logSw: | -5.6983 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.24 |
| InChI Key: | RKGQTTIXWCZAFO-UHFFFAOYSA-N |