methyl {4-[3,5-bis(trifluoromethyl)benzamido]cyclopent-2-en-1-yl}(2-fluorophenyl)acetate
Chemical Structure Depiction of
methyl {4-[3,5-bis(trifluoromethyl)benzamido]cyclopent-2-en-1-yl}(2-fluorophenyl)acetate
methyl {4-[3,5-bis(trifluoromethyl)benzamido]cyclopent-2-en-1-yl}(2-fluorophenyl)acetate
Compound characteristics
| Compound ID: | V007-2262 |
| Compound Name: | methyl {4-[3,5-bis(trifluoromethyl)benzamido]cyclopent-2-en-1-yl}(2-fluorophenyl)acetate |
| Molecular Weight: | 489.39 |
| Molecular Formula: | C23 H18 F7 N O3 |
| Smiles: | COC(C(C1CC(C=C1)NC(c1cc(cc(c1)C(F)(F)F)C(F)(F)F)=O)c1ccccc1F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.6846 |
| logD: | 5.6842 |
| logSw: | -5.4851 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.645 |
| InChI Key: | FODNEONSOZUCPZ-UHFFFAOYSA-N |