4-({2-ethyl-N-[(4-fluorophenyl)methyl]hexanamido}methyl)phenyl ethanesulfonate
Chemical Structure Depiction of
4-({2-ethyl-N-[(4-fluorophenyl)methyl]hexanamido}methyl)phenyl ethanesulfonate
4-({2-ethyl-N-[(4-fluorophenyl)methyl]hexanamido}methyl)phenyl ethanesulfonate
Compound characteristics
| Compound ID: | V007-2338 |
| Compound Name: | 4-({2-ethyl-N-[(4-fluorophenyl)methyl]hexanamido}methyl)phenyl ethanesulfonate |
| Molecular Weight: | 449.58 |
| Molecular Formula: | C24 H32 F N O4 S |
| Smiles: | CCCCC(CC)C(N(Cc1ccc(cc1)OS(CC)(=O)=O)Cc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1738 |
| logD: | 5.1738 |
| logSw: | -4.9439 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.558 |
| InChI Key: | OTHNTUXTGPKBGI-NRFANRHFSA-N |