N-(4-{4-[5-(diethylsulfamoyl)-2-methoxyphenyl]piperazine-1-sulfonyl}phenyl)acetamide
Chemical Structure Depiction of
N-(4-{4-[5-(diethylsulfamoyl)-2-methoxyphenyl]piperazine-1-sulfonyl}phenyl)acetamide
N-(4-{4-[5-(diethylsulfamoyl)-2-methoxyphenyl]piperazine-1-sulfonyl}phenyl)acetamide
Compound characteristics
| Compound ID: | V007-2520 |
| Compound Name: | N-(4-{4-[5-(diethylsulfamoyl)-2-methoxyphenyl]piperazine-1-sulfonyl}phenyl)acetamide |
| Molecular Weight: | 524.66 |
| Molecular Formula: | C23 H32 N4 O6 S2 |
| Salt: | not_available |
| Smiles: | CCN(CC)S(c1ccc(c(c1)N1CCN(CC1)S(c1ccc(cc1)NC(C)=O)(=O)=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5643 |
| logD: | 2.564 |
| logSw: | -3.0832 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 96.898 |
| InChI Key: | ADCLXUGBBCFERX-UHFFFAOYSA-N |