1-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}pentan-1-one
Chemical Structure Depiction of
1-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}pentan-1-one
1-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}pentan-1-one
Compound characteristics
| Compound ID: | V007-3009 |
| Compound Name: | 1-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}pentan-1-one |
| Molecular Weight: | 370.92 |
| Molecular Formula: | C22 H27 Cl N2 O |
| Salt: | not_available |
| Smiles: | CCCCC(N1CCN(CC1)C(c1ccccc1)c1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.966 |
| logD: | 4.965 |
| logSw: | -5.2295 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 19.1922 |
| InChI Key: | QEJJMFRDAATTBI-QFIPXVFZSA-N |