[5-ethyl-1-(4-fluorophenyl)-3-(2-methylpropyl)-1H-pyrazol-4-yl](4-ethylpiperazin-1-yl)methanone
Chemical Structure Depiction of
[5-ethyl-1-(4-fluorophenyl)-3-(2-methylpropyl)-1H-pyrazol-4-yl](4-ethylpiperazin-1-yl)methanone
[5-ethyl-1-(4-fluorophenyl)-3-(2-methylpropyl)-1H-pyrazol-4-yl](4-ethylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | V007-3918 |
| Compound Name: | [5-ethyl-1-(4-fluorophenyl)-3-(2-methylpropyl)-1H-pyrazol-4-yl](4-ethylpiperazin-1-yl)methanone |
| Molecular Weight: | 386.51 |
| Molecular Formula: | C22 H31 F N4 O |
| Salt: | not_available |
| Smiles: | CCc1c(C(N2CCN(CC)CC2)=O)c(CC(C)C)nn1c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.6855 |
| logD: | 3.5093 |
| logSw: | -4.1173 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.041 |
| InChI Key: | YRAFNUJMOFNNJW-UHFFFAOYSA-N |