N-(3,4-dimethylphenyl)-1-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-1-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
N-(3,4-dimethylphenyl)-1-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
Compound characteristics
| Compound ID: | V007-4023 |
| Compound Name: | N-(3,4-dimethylphenyl)-1-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide |
| Molecular Weight: | 359.47 |
| Molecular Formula: | C23 H25 N3 O |
| Smiles: | Cc1ccc(cc1)C1c2cccn2CCN1C(Nc1ccc(C)c(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5807 |
| logD: | 5.5807 |
| logSw: | -5.2905 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.1817 |
| InChI Key: | CBUIVSWWNFSEHG-JOCHJYFZSA-N |