N-(butan-2-yl)-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)cyclopentanecarboxamide
Chemical Structure Depiction of
N-(butan-2-yl)-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)cyclopentanecarboxamide
N-(butan-2-yl)-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)cyclopentanecarboxamide
Compound characteristics
| Compound ID: | V007-4063 |
| Compound Name: | N-(butan-2-yl)-N-({2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)cyclopentanecarboxamide |
| Molecular Weight: | 386.56 |
| Molecular Formula: | C22 H30 N2 O2 S |
| Smiles: | CCC(C)N(Cc1csc(COc2ccc(C)cc2)n1)C(C1CCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6087 |
| logD: | 5.6087 |
| logSw: | -5.1928 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.559 |
| InChI Key: | SAEGLYSCWSYOMV-KRWDZBQOSA-N |