1-(2-methyl-4-{[4-(2-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]acetyl}piperazin-1-yl)-2-phenoxyethan-1-one
Chemical Structure Depiction of
1-(2-methyl-4-{[4-(2-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]acetyl}piperazin-1-yl)-2-phenoxyethan-1-one
1-(2-methyl-4-{[4-(2-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]acetyl}piperazin-1-yl)-2-phenoxyethan-1-one
Compound characteristics
| Compound ID: | V007-6461 |
| Compound Name: | 1-(2-methyl-4-{[4-(2-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]acetyl}piperazin-1-yl)-2-phenoxyethan-1-one |
| Molecular Weight: | 503.66 |
| Molecular Formula: | C29 H33 N3 O3 S |
| Salt: | not_available |
| Smiles: | CC1CN(CCN1C(COc1ccccc1)=O)C(CN1CCc2c(ccs2)C1c1ccccc1C)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.3573 |
| logD: | 4.3323 |
| logSw: | -4.1752 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.168 |
| InChI Key: | IKIYHGASBVNJMM-UHFFFAOYSA-N |