{4-[5-benzyl-6-methyl-2-(3-methylphenyl)pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
Chemical Structure Depiction of
{4-[5-benzyl-6-methyl-2-(3-methylphenyl)pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
{4-[5-benzyl-6-methyl-2-(3-methylphenyl)pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | V007-6534 |
| Compound Name: | {4-[5-benzyl-6-methyl-2-(3-methylphenyl)pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone |
| Molecular Weight: | 468.62 |
| Molecular Formula: | C28 H28 N4 O S |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1)c1nc(C)c(Cc2ccccc2)c(n1)N1CCN(CC1)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8319 |
| logD: | 6.6677 |
| logSw: | -5.6843 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.703 |
| InChI Key: | IAJGLSHOPZNHOG-UHFFFAOYSA-N |