1-{[(4-methoxyphenyl)methyl](3-methoxypropyl)amino}-3-phenoxypropan-2-ol
Chemical Structure Depiction of
1-{[(4-methoxyphenyl)methyl](3-methoxypropyl)amino}-3-phenoxypropan-2-ol
1-{[(4-methoxyphenyl)methyl](3-methoxypropyl)amino}-3-phenoxypropan-2-ol
Compound characteristics
| Compound ID: | V007-6864 |
| Compound Name: | 1-{[(4-methoxyphenyl)methyl](3-methoxypropyl)amino}-3-phenoxypropan-2-ol |
| Molecular Weight: | 359.46 |
| Molecular Formula: | C21 H29 N O4 |
| Smiles: | COCCCN(CC(COc1ccccc1)O)Cc1ccc(cc1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3135 |
| logD: | 3.1403 |
| logSw: | -3.1349 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.933 |
| InChI Key: | OJXWZCKFRZEVGN-IBGZPJMESA-N |