4-{[N-(benzenesulfonyl)-N-propylglycyl][(4-methoxyphenyl)methyl]amino}-N-(4-ethylphenyl)piperidine-1-carboxamide
Chemical Structure Depiction of
4-{[N-(benzenesulfonyl)-N-propylglycyl][(4-methoxyphenyl)methyl]amino}-N-(4-ethylphenyl)piperidine-1-carboxamide
4-{[N-(benzenesulfonyl)-N-propylglycyl][(4-methoxyphenyl)methyl]amino}-N-(4-ethylphenyl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | V007-7528 |
| Compound Name: | 4-{[N-(benzenesulfonyl)-N-propylglycyl][(4-methoxyphenyl)methyl]amino}-N-(4-ethylphenyl)piperidine-1-carboxamide |
| Molecular Weight: | 606.79 |
| Molecular Formula: | C33 H42 N4 O5 S |
| Smiles: | CCCN(CC(N(Cc1ccc(cc1)OC)C1CCN(CC1)C(Nc1ccc(CC)cc1)=O)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6171 |
| logD: | 5.6171 |
| logSw: | -5.3777 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.341 |
| InChI Key: | RBTMABILYFLJNJ-UHFFFAOYSA-N |