4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl 2,3-dichlorobenzene-1-sulfonate
Chemical Structure Depiction of
4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl 2,3-dichlorobenzene-1-sulfonate
4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl 2,3-dichlorobenzene-1-sulfonate
Compound characteristics
| Compound ID: | V007-7735 |
| Compound Name: | 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl 2,3-dichlorobenzene-1-sulfonate |
| Molecular Weight: | 435.28 |
| Molecular Formula: | C19 H12 Cl2 N2 O4 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(c(c1)c1nc2c(cccn2)o1)OS(c1cccc(c1[Cl])[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8986 |
| logD: | 4.8986 |
| logSw: | -5.1714 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.271 |
| InChI Key: | XLCJZOXDYVWGOR-UHFFFAOYSA-N |