N-(4-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}-1,3-thiazol-2-yl)-3-methylbutanamide
Chemical Structure Depiction of
N-(4-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}-1,3-thiazol-2-yl)-3-methylbutanamide
N-(4-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}-1,3-thiazol-2-yl)-3-methylbutanamide
Compound characteristics
| Compound ID: | V007-8885 |
| Compound Name: | N-(4-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}-1,3-thiazol-2-yl)-3-methylbutanamide |
| Molecular Weight: | 367.51 |
| Molecular Formula: | C17 H29 N5 O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CC(Nc1nc(cs1)C(N1CCN(CCN(C)C)CC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5067 |
| logD: | 0.6047 |
| logSw: | -2.2618 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.739 |
| InChI Key: | JEFOTVBNEGELFY-UHFFFAOYSA-N |