4-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-phenyl-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Chemical Structure Depiction of
4-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-phenyl-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
4-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-phenyl-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Compound characteristics
| Compound ID: | V007-9306 |
| Compound Name: | 4-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-phenyl-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide |
| Molecular Weight: | 430.44 |
| Molecular Formula: | C24 H19 F N4 O3 |
| Smiles: | Cc1ccc(cc1)N1C(N(Cc2ccccc2F)C(C(C(Nc2ccccc2)=O)=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3993 |
| logD: | 4.357 |
| logSw: | -4.2273 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.336 |
| InChI Key: | DOXNJYXFVPOJPO-UHFFFAOYSA-N |