2-(2-fluorophenyl)-N-(3-methoxypropyl)-4-[(4-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Chemical Structure Depiction of
2-(2-fluorophenyl)-N-(3-methoxypropyl)-4-[(4-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
2-(2-fluorophenyl)-N-(3-methoxypropyl)-4-[(4-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Compound characteristics
| Compound ID: | V007-9612 |
| Compound Name: | 2-(2-fluorophenyl)-N-(3-methoxypropyl)-4-[(4-methylphenyl)methyl]-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide |
| Molecular Weight: | 426.45 |
| Molecular Formula: | C22 H23 F N4 O4 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN2C(C(C(NCCCOC)=O)=NN(C2=O)c2ccccc2F)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.7729 |
| logD: | 2.7729 |
| logSw: | -3.1842 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.813 |
| InChI Key: | WMTXHEJGTHBQIL-UHFFFAOYSA-N |