1-[(4-bromophenyl)methyl]-4-(3,5-difluorophenyl)-1H-indol-5-yl diethylcarbamate
Chemical Structure Depiction of
1-[(4-bromophenyl)methyl]-4-(3,5-difluorophenyl)-1H-indol-5-yl diethylcarbamate
1-[(4-bromophenyl)methyl]-4-(3,5-difluorophenyl)-1H-indol-5-yl diethylcarbamate
Compound characteristics
| Compound ID: | V008-0756 |
| Compound Name: | 1-[(4-bromophenyl)methyl]-4-(3,5-difluorophenyl)-1H-indol-5-yl diethylcarbamate |
| Molecular Weight: | 513.38 |
| Molecular Formula: | C26 H23 Br F2 N2 O2 |
| Smiles: | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccc(cc2)[Br])c1c1cc(cc(c1)F)F |
| Stereo: | ACHIRAL |
| logP: | 7.0656 |
| logD: | 7.0656 |
| logSw: | -5.9383 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.7727 |
| InChI Key: | KUNNKTFWLASEJV-UHFFFAOYSA-N |