2,4-dichloro-N-{4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Chemical Structure Depiction of
2,4-dichloro-N-{4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
2,4-dichloro-N-{4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V008-1003 |
| Compound Name: | 2,4-dichloro-N-{4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide |
| Molecular Weight: | 457.38 |
| Molecular Formula: | C23 H18 Cl2 N2 O2 S |
| Smiles: | Cc1ccc(cc1)N1C(c2ccc(cc2)NC(c2ccc(cc2[Cl])[Cl])=O)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6869 |
| logD: | 5.6802 |
| logSw: | -6.0177 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.224 |
| InChI Key: | AIYBWDNXLCJASG-QHCPKHFHSA-N |