(3-chlorophenyl)[1-(4-chlorophenyl)-3,4-dihydroisoquinolin-2(1H)-yl]methanone
Chemical Structure Depiction of
(3-chlorophenyl)[1-(4-chlorophenyl)-3,4-dihydroisoquinolin-2(1H)-yl]methanone
(3-chlorophenyl)[1-(4-chlorophenyl)-3,4-dihydroisoquinolin-2(1H)-yl]methanone
Compound characteristics
| Compound ID: | V008-1835 |
| Compound Name: | (3-chlorophenyl)[1-(4-chlorophenyl)-3,4-dihydroisoquinolin-2(1H)-yl]methanone |
| Molecular Weight: | 382.29 |
| Molecular Formula: | C22 H17 Cl2 N O |
| Smiles: | C1CN(C(c2ccc(cc2)[Cl])c2ccccc12)C(c1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2433 |
| logD: | 6.2433 |
| logSw: | -6.4773 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.8613 |
| InChI Key: | SMSJVQQHLJCRNK-NRFANRHFSA-N |