N-(3-fluorophenyl)-3-[1-(4-methoxyphenyl)-3-methyl-5-(2-methylphenoxy)-1H-pyrazol-4-yl]propanamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-3-[1-(4-methoxyphenyl)-3-methyl-5-(2-methylphenoxy)-1H-pyrazol-4-yl]propanamide
N-(3-fluorophenyl)-3-[1-(4-methoxyphenyl)-3-methyl-5-(2-methylphenoxy)-1H-pyrazol-4-yl]propanamide
Compound characteristics
| Compound ID: | V008-1891 |
| Compound Name: | N-(3-fluorophenyl)-3-[1-(4-methoxyphenyl)-3-methyl-5-(2-methylphenoxy)-1H-pyrazol-4-yl]propanamide |
| Molecular Weight: | 459.52 |
| Molecular Formula: | C27 H26 F N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccccc1Oc1c(CCC(Nc2cccc(c2)F)=O)c(C)nn1c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.4786 |
| logD: | 5.4783 |
| logSw: | -5.4432 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.428 |
| InChI Key: | AYBJEXBXVCQDTO-UHFFFAOYSA-N |