3-[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]-N-(4-methylphenyl)propanamide
Chemical Structure Depiction of
3-[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]-N-(4-methylphenyl)propanamide
3-[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]-N-(4-methylphenyl)propanamide
Compound characteristics
| Compound ID: | V008-1974 |
| Compound Name: | 3-[5-(2,4-difluorophenoxy)-3-methyl-1-phenyl-1H-pyrazol-4-yl]-N-(4-methylphenyl)propanamide |
| Molecular Weight: | 447.48 |
| Molecular Formula: | C26 H23 F2 N3 O2 |
| Smiles: | Cc1ccc(cc1)NC(CCc1c(C)nn(c2ccccc2)c1Oc1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4925 |
| logD: | 5.4924 |
| logSw: | -5.4179 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.884 |
| InChI Key: | AQEWZPVVRGNNGH-UHFFFAOYSA-N |