2-(4-benzylpiperidin-1-yl)-1-[3-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-benzylpiperidin-1-yl)-1-[3-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
2-(4-benzylpiperidin-1-yl)-1-[3-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | V008-2377 |
| Compound Name: | 2-(4-benzylpiperidin-1-yl)-1-[3-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one |
| Molecular Weight: | 502.06 |
| Molecular Formula: | C30 H32 Cl N3 O2 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1)C1CC(c2ccccc2[Cl])=NN1C(CN1CCC(CC1)Cc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.427 |
| logD: | 6.3506 |
| logSw: | -6.0875 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.863 |
| InChI Key: | ZGCHHNAJJLYJJU-GDLZYMKVSA-N |