N-(cyclopropylmethyl)-N-(2-{4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl}-2-oxoethyl)-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-(cyclopropylmethyl)-N-(2-{4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl}-2-oxoethyl)-4-methylbenzene-1-sulfonamide
N-(cyclopropylmethyl)-N-(2-{4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl}-2-oxoethyl)-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V008-2511 |
| Compound Name: | N-(cyclopropylmethyl)-N-(2-{4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl}-2-oxoethyl)-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 537.66 |
| Molecular Formula: | C28 H32 F N5 O3 S |
| Smiles: | Cc1ccc(cc1)S(N(CC1CC1)CC(N1CCCN(CC1)c1ccc(c2ccc(cc2)F)nn1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5305 |
| logD: | 4.5287 |
| logSw: | -4.1471 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.784 |
| InChI Key: | WBZADCCHGNKJLB-UHFFFAOYSA-N |