1-(3-fluorophenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]-N-[(oxolan-2-yl)methyl]-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
1-(3-fluorophenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]-N-[(oxolan-2-yl)methyl]-1H-pyrazole-3-carboxamide
1-(3-fluorophenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]-N-[(oxolan-2-yl)methyl]-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | V008-3251 |
| Compound Name: | 1-(3-fluorophenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]-N-[(oxolan-2-yl)methyl]-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 561.59 |
| Molecular Formula: | C25 H28 F N5 O7 S |
| Salt: | not_available |
| Smiles: | CCCNS(c1cc(ccc1Oc1c(C)c(C(NCC2CCCO2)=O)nn1c1cccc(c1)F)[N+]([O-])=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7053 |
| logD: | 3.7051 |
| logSw: | -3.9283 |
| Hydrogen bond acceptors count: | 14 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 129.521 |
| InChI Key: | CWEQKZXITUJVRL-HXUWFJFHSA-N |