1-[{[5-(4-chlorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}(cyclopropyl)amino]-3-[(propan-2-yl)oxy]propan-2-ol
Chemical Structure Depiction of
1-[{[5-(4-chlorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}(cyclopropyl)amino]-3-[(propan-2-yl)oxy]propan-2-ol
1-[{[5-(4-chlorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}(cyclopropyl)amino]-3-[(propan-2-yl)oxy]propan-2-ol
Compound characteristics
| Compound ID: | V008-3311 |
| Compound Name: | 1-[{[5-(4-chlorophenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}(cyclopropyl)amino]-3-[(propan-2-yl)oxy]propan-2-ol |
| Molecular Weight: | 470.01 |
| Molecular Formula: | C26 H32 Cl N3 O3 |
| Salt: | not_available |
| Smiles: | CC(C)OCC(CN(Cc1c(c2ccccc2)nn(C)c1Oc1ccc(cc1)[Cl])C1CC1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8015 |
| logD: | 3.7575 |
| logSw: | -4.819 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.345 |
| InChI Key: | KCCLDSAIJXTCNS-QFIPXVFZSA-N |