N-{3-[(butan-2-yl)sulfamoyl]-4-(2-methylpiperidin-1-yl)phenyl}octanamide
Chemical Structure Depiction of
N-{3-[(butan-2-yl)sulfamoyl]-4-(2-methylpiperidin-1-yl)phenyl}octanamide
N-{3-[(butan-2-yl)sulfamoyl]-4-(2-methylpiperidin-1-yl)phenyl}octanamide
Compound characteristics
| Compound ID: | V008-3355 |
| Compound Name: | N-{3-[(butan-2-yl)sulfamoyl]-4-(2-methylpiperidin-1-yl)phenyl}octanamide |
| Molecular Weight: | 451.67 |
| Molecular Formula: | C24 H41 N3 O3 S |
| Salt: | not_available |
| Smiles: | CCCCCCCC(Nc1ccc(c(c1)S(NC(C)CC)(=O)=O)N1CCCCC1C)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.7609 |
| logD: | 5.7606 |
| logSw: | -5.259 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.509 |
| InChI Key: | PXOUBCVBMMJMIP-UHFFFAOYSA-N |