N-(2-{[(furan-2-yl)methyl]amino}-2-oxo-1-{1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl}ethyl)-3-methylbenzamide
Chemical Structure Depiction of
N-(2-{[(furan-2-yl)methyl]amino}-2-oxo-1-{1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl}ethyl)-3-methylbenzamide
N-(2-{[(furan-2-yl)methyl]amino}-2-oxo-1-{1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl}ethyl)-3-methylbenzamide
Compound characteristics
| Compound ID: | V008-3691 |
| Compound Name: | N-(2-{[(furan-2-yl)methyl]amino}-2-oxo-1-{1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl}ethyl)-3-methylbenzamide |
| Molecular Weight: | 527.54 |
| Molecular Formula: | C28 H28 F3 N3 O4 |
| Smiles: | Cc1cccc(c1)C(NC(C1CCN(CC1)C(c1ccc(cc1)C(F)(F)F)=O)C(NCc1ccco1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2833 |
| logD: | 4.2832 |
| logSw: | -4.2754 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.814 |
| InChI Key: | WVOVBUCCEYVJKX-DEOSSOPVSA-N |