ethyl 1-[3-(1-benzyl-5-nitro-1H-indol-3-yl)-3-(3-fluorophenyl)propanoyl]piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[3-(1-benzyl-5-nitro-1H-indol-3-yl)-3-(3-fluorophenyl)propanoyl]piperidine-3-carboxylate
ethyl 1-[3-(1-benzyl-5-nitro-1H-indol-3-yl)-3-(3-fluorophenyl)propanoyl]piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V008-3740 |
| Compound Name: | ethyl 1-[3-(1-benzyl-5-nitro-1H-indol-3-yl)-3-(3-fluorophenyl)propanoyl]piperidine-3-carboxylate |
| Molecular Weight: | 557.62 |
| Molecular Formula: | C32 H32 F N3 O5 |
| Smiles: | CCOC(C1CCCN(C1)C(CC(c1cccc(c1)F)c1cn(Cc2ccccc2)c2ccc(cc12)[N+]([O-])=O)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.8567 |
| logD: | 5.8567 |
| logSw: | -5.4407 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 71.889 |
| InChI Key: | RBVOUJRNSYIGFW-UHFFFAOYSA-N |