N-{3-[6-(2,5-dimethoxyphenyl)pyridin-2-yl]phenyl}-3-methylbut-2-enamide
Chemical Structure Depiction of
N-{3-[6-(2,5-dimethoxyphenyl)pyridin-2-yl]phenyl}-3-methylbut-2-enamide
N-{3-[6-(2,5-dimethoxyphenyl)pyridin-2-yl]phenyl}-3-methylbut-2-enamide
Compound characteristics
| Compound ID: | V008-3855 |
| Compound Name: | N-{3-[6-(2,5-dimethoxyphenyl)pyridin-2-yl]phenyl}-3-methylbut-2-enamide |
| Molecular Weight: | 388.47 |
| Molecular Formula: | C24 H24 N2 O3 |
| Salt: | not_available |
| Smiles: | CC(C)=CC(Nc1cccc(c1)c1cccc(c2cc(ccc2OC)OC)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5402 |
| logD: | 5.3439 |
| logSw: | -5.5731 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.635 |
| InChI Key: | PGWXNKOHVAOSRG-UHFFFAOYSA-N |