ethyl N-{[4-(dimethylamino)-3-{[2,2-dimethyl-N-(1-phenylethyl)propanamido]methyl}phenyl]carbamoyl}glycinate
Chemical Structure Depiction of
ethyl N-{[4-(dimethylamino)-3-{[2,2-dimethyl-N-(1-phenylethyl)propanamido]methyl}phenyl]carbamoyl}glycinate
ethyl N-{[4-(dimethylamino)-3-{[2,2-dimethyl-N-(1-phenylethyl)propanamido]methyl}phenyl]carbamoyl}glycinate
Compound characteristics
| Compound ID: | V008-3877 |
| Compound Name: | ethyl N-{[4-(dimethylamino)-3-{[2,2-dimethyl-N-(1-phenylethyl)propanamido]methyl}phenyl]carbamoyl}glycinate |
| Molecular Weight: | 482.62 |
| Molecular Formula: | C27 H38 N4 O4 |
| Salt: | not_available |
| Smiles: | CCOC(CNC(Nc1ccc(c(CN(C(C)c2ccccc2)C(C(C)(C)C)=O)c1)N(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7858 |
| logD: | 4.784 |
| logSw: | -4.3856 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.373 |
| InChI Key: | JBFOHMCRRZBGKC-IBGZPJMESA-N |