ethyl 5-(4-cyclohexylphenyl)-1-(4-{[(3-methoxyphenyl)methyl]carbamoyl}phenyl)-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
ethyl 5-(4-cyclohexylphenyl)-1-(4-{[(3-methoxyphenyl)methyl]carbamoyl}phenyl)-1H-pyrazole-3-carboxylate
ethyl 5-(4-cyclohexylphenyl)-1-(4-{[(3-methoxyphenyl)methyl]carbamoyl}phenyl)-1H-pyrazole-3-carboxylate
Compound characteristics
| Compound ID: | V008-5290 |
| Compound Name: | ethyl 5-(4-cyclohexylphenyl)-1-(4-{[(3-methoxyphenyl)methyl]carbamoyl}phenyl)-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 537.66 |
| Molecular Formula: | C33 H35 N3 O4 |
| Smiles: | CCOC(c1cc(c2ccc(cc2)C2CCCCC2)n(c2ccc(cc2)C(NCc2cccc(c2)OC)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 7.284 |
| logD: | 7.284 |
| logSw: | -5.5705 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.693 |
| InChI Key: | DYYDOPSCHLDGDC-UHFFFAOYSA-N |