(2,6-difluoro-3-methylphenyl)[4-(diphenylmethyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(2,6-difluoro-3-methylphenyl)[4-(diphenylmethyl)piperazin-1-yl]methanone
(2,6-difluoro-3-methylphenyl)[4-(diphenylmethyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | V008-6027 |
| Compound Name: | (2,6-difluoro-3-methylphenyl)[4-(diphenylmethyl)piperazin-1-yl]methanone |
| Molecular Weight: | 406.47 |
| Molecular Formula: | C25 H24 F2 N2 O |
| Salt: | not_available |
| Smiles: | Cc1ccc(c(C(N2CCN(CC2)C(c2ccccc2)c2ccccc2)=O)c1F)F |
| Stereo: | ACHIRAL |
| logP: | 5.39 |
| logD: | 5.3884 |
| logSw: | -5.4944 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 19.4481 |
| InChI Key: | FZZJQNONIDCKGR-UHFFFAOYSA-N |