1-tert-butoxy-3-{[(2,3-dimethoxyphenyl)methyl][(furan-2-yl)methyl]amino}propan-2-ol
Chemical Structure Depiction of
1-tert-butoxy-3-{[(2,3-dimethoxyphenyl)methyl][(furan-2-yl)methyl]amino}propan-2-ol
1-tert-butoxy-3-{[(2,3-dimethoxyphenyl)methyl][(furan-2-yl)methyl]amino}propan-2-ol
Compound characteristics
| Compound ID: | V008-6805 |
| Compound Name: | 1-tert-butoxy-3-{[(2,3-dimethoxyphenyl)methyl][(furan-2-yl)methyl]amino}propan-2-ol |
| Molecular Weight: | 377.48 |
| Molecular Formula: | C21 H31 N O5 |
| Salt: | not_available |
| Smiles: | CC(C)(C)OCC(CN(Cc1cccc(c1OC)OC)Cc1ccco1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6878 |
| logD: | 3.2648 |
| logSw: | -3.895 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.379 |
| InChI Key: | JOJNCBWUYWXKGA-KRWDZBQOSA-N |