3-(4-chlorophenyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-chlorophenyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
3-(4-chlorophenyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | V008-6852 |
| Compound Name: | 3-(4-chlorophenyl)-2-{[(3-methoxyphenyl)methyl]sulfanyl}quinazolin-4(3H)-one |
| Molecular Weight: | 408.9 |
| Molecular Formula: | C22 H17 Cl N2 O2 S |
| Smiles: | COc1cccc(CSC2=Nc3ccccc3C(N2c2ccc(cc2)[Cl])=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.8264 |
| logD: | 4.8263 |
| logSw: | -4.9559 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.703 |
| InChI Key: | FPAGOQFLRDAVHX-UHFFFAOYSA-N |