N-{4-[5-(4-fluorophenyl)-3-(2-methylpropoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
Chemical Structure Depiction of
N-{4-[5-(4-fluorophenyl)-3-(2-methylpropoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
N-{4-[5-(4-fluorophenyl)-3-(2-methylpropoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide
Compound characteristics
| Compound ID: | V008-7530 |
| Compound Name: | N-{4-[5-(4-fluorophenyl)-3-(2-methylpropoxy)-1H-1,2,4-triazol-1-yl]phenyl}-4-methoxybenzamide |
| Molecular Weight: | 460.51 |
| Molecular Formula: | C26 H25 F N4 O3 |
| Salt: | not_available |
| Smiles: | CC(C)COc1nc(c2ccc(cc2)F)n(c2ccc(cc2)NC(c2ccc(cc2)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.0398 |
| logD: | 6.0398 |
| logSw: | -5.6252 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.824 |
| InChI Key: | IOXQRTVGQSEXEJ-UHFFFAOYSA-N |