ethyl 1-(3-fluorophenyl)-5-{4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl}-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-(3-fluorophenyl)-5-{4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl}-1H-pyrazole-3-carboxylate
ethyl 1-(3-fluorophenyl)-5-{4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl}-1H-pyrazole-3-carboxylate
Compound characteristics
| Compound ID: | V008-7543 |
| Compound Name: | ethyl 1-(3-fluorophenyl)-5-{4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl}-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 528.58 |
| Molecular Formula: | C30 H29 F N4 O4 |
| Salt: | not_available |
| Smiles: | CCOC(c1cc(c2ccc(cc2)N2CCN(CC2)C(c2ccccc2OC)=O)n(c2cccc(c2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9683 |
| logD: | 4.9683 |
| logSw: | -4.6503 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.354 |
| InChI Key: | ORKUMRMLMVCPHH-UHFFFAOYSA-N |