1-[4-(2,4-dichlorophenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-2-{[(4-fluorophenyl)methyl]amino}ethan-1-one
Chemical Structure Depiction of
1-[4-(2,4-dichlorophenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-2-{[(4-fluorophenyl)methyl]amino}ethan-1-one
1-[4-(2,4-dichlorophenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-2-{[(4-fluorophenyl)methyl]amino}ethan-1-one
Compound characteristics
| Compound ID: | V008-7897 |
| Compound Name: | 1-[4-(2,4-dichlorophenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-2-{[(4-fluorophenyl)methyl]amino}ethan-1-one |
| Molecular Weight: | 449.37 |
| Molecular Formula: | C22 H19 Cl2 F N2 O S |
| Salt: | not_available |
| Smiles: | C1CN(C(c2ccc(cc2[Cl])[Cl])c2ccsc12)C(CNCc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5779 |
| logD: | 5.5704 |
| logSw: | -5.9839 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.3896 |
| InChI Key: | MMXRXKMVDDEWDR-JOCHJYFZSA-N |